C16H10Cl2N2O3 — CID 91358186
1-(2,4-dichlorophenyl)-3-[4-(3-oxoprop-2-enoyl)phenyl]urea (PubChem CID 91358186) has the molecular formula C16H10Cl2N2O3 and a molecular weight of 349.17 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[4-(3-oxoprop-2-enoyl)phenyl]urea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[4-(3-oxoprop-2-enoyl)phenyl]urea |
|---|---|
| PubChem CID | 91358186 |
| Molecular Formula | C16H10Cl2N2O3 |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[4-(3-oxoprop-2-enoyl)phenyl]urea |
| SMILES | O=C=CC(=O)c1ccc(NC(=O)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H10Cl2N2O3/c17-11-3-6-14(13(18)9-11)20-16(23)19-12-4-1-10(2-5-12)15(22)7-8-21/h1-7,9H,(H2,19,20,23) |
| InChIKey | QHNDMUPUMLCZSA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|