C19H26O5S — CID 70371610
dicyclohexyl 3-hydroxy-4-methylthiophene-2,5-dicarboxylate (PubChem CID 70371610) has the molecular formula C19H26O5S and a molecular weight of 366.48 g/mol. Its IUPAC name is dicyclohexyl 3-hydroxy-4-methylthiophene-2,5-dicarboxylate.
| Compound Name | dicyclohexyl 3-hydroxy-4-methylthiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 70371610 |
| Molecular Formula | C19H26O5S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | dicyclohexyl 3-hydroxy-4-methylthiophene-2,5-dicarboxylate |
| SMILES | Cc1c(C(=O)OC2CCCCC2)sc(C(=O)OC2CCCCC2)c1O |
| InChI | InChI=1S/C19H26O5S/c1-12-15(20)17(19(22)24-14-10-6-3-7-11-14)25-16(12)18(21)23-13-8-4-2-5-9-13/h13-14,20H,2-11H2,1H3 |
| InChIKey | NCKDNXDHPJYNSV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|