C22H30N2O6S — CID 70373765
(2-methyl-3aH-imidazo[2,1-b][1,3]benzothiazol-3-yl)methyl nonanoate;oxalic acid (PubChem CID 70373765) has the molecular formula C22H30N2O6S and a molecular weight of 450.56 g/mol. Its IUPAC name is (2-methyl-3aH-imidazo[2,1-b][1,3]benzothiazol-3-yl)methyl nonanoate;oxalic acid.
| Compound Name | (2-methyl-3aH-imidazo[2,1-b][1,3]benzothiazol-3-yl)methyl nonanoate;oxalic acid |
|---|---|
| PubChem CID | 70373765 |
| Molecular Formula | C22H30N2O6S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (2-methyl-3aH-imidazo[2,1-b][1,3]benzothiazol-3-yl)methyl nonanoate;oxalic acid |
| SMILES | CCCCCCCCC(=O)OCN1C(C)=CN2c3ccccc3SC12.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H28N2O2S.C2H2O4/c1-3-4-5-6-7-8-13-19(23)24-15-22-16(2)14-21-17-11-9-10-12-18(17)25-20(21)22;3-1(4)2(5)6/h9-12,14,20H,3-8,13,15H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | WCVNLZUQFICBFL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|