C30H47N3O6S — CID 70377847
N,N-diethyl-3-[4-[6-[[2-hydroxy-1-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]hexoxy]butyl]benzamide (PubChem CID 70377847) has the molecular formula C30H47N3O6S and a molecular weight of 577.79 g/mol. Its IUPAC name is N,N-diethyl-3-[4-[6-[[2-hydroxy-1-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]hexoxy]butyl]benzamide.
| Compound Name | N,N-diethyl-3-[4-[6-[[2-hydroxy-1-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]hexoxy]butyl]benzamide |
|---|---|
| PubChem CID | 70377847 |
| Molecular Formula | C30H47N3O6S |
| Molecular Weight | 577.79 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | N,N-diethyl-3-[4-[6-[[2-hydroxy-1-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]hexoxy]butyl]benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(CCCCOCCCCCCNC(CO)c2ccc(O)c(NS(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C30H47N3O6S/c1-4-33(5-2)30(36)26-15-12-14-24(21-26)13-8-11-20-39-19-10-7-6-9-18-31-28(23-34)25-16-17-29(35)27(22-25)32-40(3,37)38/h12,14-17,21-22,28,31-32,34-35H,4-11,13,18-20,23H2,1-3H3 |
| InChIKey | LEXGMPNZCLYFSQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.79 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|