C31H40N2O5S2 — CID 67922997
[1-[4-hydroxy-3-(methanesulfonamido)phenyl]-2-[6-(3-phenylpropylsulfanyl)hexylamino]ethyl] benzoate (PubChem CID 67922997) has the molecular formula C31H40N2O5S2 and a molecular weight of 584.80 g/mol. Its IUPAC name is [1-[4-hydroxy-3-(methanesulfonamido)phenyl]-2-[6-(3-phenylpropylsulfanyl)hexylamino]ethyl] benzoate.
| Compound Name | [1-[4-hydroxy-3-(methanesulfonamido)phenyl]-2-[6-(3-phenylpropylsulfanyl)hexylamino]ethyl] benzoate |
|---|---|
| PubChem CID | 67922997 |
| Molecular Formula | C31H40N2O5S2 |
| Molecular Weight | 584.80 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | [1-[4-hydroxy-3-(methanesulfonamido)phenyl]-2-[6-(3-phenylpropylsulfanyl)hexylamino]ethyl] benzoate |
| SMILES | CS(=O)(=O)Nc1cc(C(CNCCCCCCSCCCc2ccccc2)OC(=O)c2ccccc2)ccc1O |
| InChI | InChI=1S/C31H40N2O5S2/c1-40(36,37)33-28-23-27(18-19-29(28)34)30(38-31(35)26-16-8-5-9-17-26)24-32-20-10-2-3-11-21-39-22-12-15-25-13-6-4-7-14-25/h4-9,13-14,16-19,23,30,32-34H,2-3,10-12,15,20-22,24H2,1H3 |
| InChIKey | FTSJBFFPVNFOCI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.80 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|