C39H51ClN4O4 — CID 70378034
7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;dodecyl pyridine-3-carboxylate;1-methylpyrrolidin-2-one (PubChem CID 70378034) has the molecular formula C39H51ClN4O4 and a molecular weight of 675.31 g/mol. Its IUPAC name is 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;dodecyl pyridine-3-carboxylate;1-methylpyrrolidin-2-one.
| Compound Name | 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;dodecyl pyridine-3-carboxylate;1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 70378034 |
| Molecular Formula | C39H51ClN4O4 |
| Molecular Weight | 675.31 g/mol |
| Exact Mass | 674.36 |
| IUPAC Name | 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;dodecyl pyridine-3-carboxylate;1-methylpyrrolidin-2-one |
| SMILES | CCCCCCCCCCCCOC(=O)c1cccnc1.CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21.CN1CCCC1=O |
| InChI | InChI=1S/C18H29NO2.C16H13ClN2O.C5H9NO/c1-2-3-4-5-6-7-8-9-10-11-15-21-18(20)17-13-12-14-19-16-17;1-19-14-8-7-12(17)9-13(14)16(18-10-15(19)20)11-5-3-2-4-6-11;1-6-4-2-3-5(6)7/h12-14,16H,2-11,15H2,1H3;2-9H,10H2,1H3;2-4H2,1H3 |
| InChIKey | GVZGXRVTYAVZGL-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 92.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.31 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|