C15H20N2 — CID 70378457
2,6-diethyl-4-methyl-3-phenyl-1H-pyridazine (PubChem CID 70378457) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2,6-diethyl-4-methyl-3-phenyl-1H-pyridazine.
| Compound Name | 2,6-diethyl-4-methyl-3-phenyl-1H-pyridazine |
|---|---|
| PubChem CID | 70378457 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2,6-diethyl-4-methyl-3-phenyl-1H-pyridazine |
| SMILES | CCC1=CC(C)=C(c2ccccc2)N(CC)N1 |
| InChI | InChI=1S/C15H20N2/c1-4-14-11-12(3)15(17(5-2)16-14)13-9-7-6-8-10-13/h6-11,16H,4-5H2,1-3H3 |
| InChIKey | NSMGNTOZWFOUMX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |