C17H20N4 — CID 91447150
2,5-dimethyltetrazole;1-ethyl-4-phenylbenzene (PubChem CID 91447150) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is 2,5-dimethyltetrazole;1-ethyl-4-phenylbenzene.
| Compound Name | 2,5-dimethyltetrazole;1-ethyl-4-phenylbenzene |
|---|---|
| PubChem CID | 91447150 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2,5-dimethyltetrazole;1-ethyl-4-phenylbenzene |
| SMILES | CCc1ccc(-c2ccccc2)cc1.Cc1nnn(C)n1 |
| InChI | InChI=1S/C14H14.C3H6N4/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13;1-3-4-6-7(2)5-3/h3-11H,2H2,1H3;1-2H3 |
| InChIKey | WVLCSYODCHHBBY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |