C22H23F2N — CID 158448173
ethane;1-ethyl-5-fluoro-2-(2-fluorophenyl)-6-methylidene-3-phenylpyridine (PubChem CID 158448173) has the molecular formula C22H23F2N and a molecular weight of 339.43 g/mol. Its IUPAC name is ethane;1-ethyl-5-fluoro-2-(2-fluorophenyl)-6-methylidene-3-phenylpyridine.
| Compound Name | ethane;1-ethyl-5-fluoro-2-(2-fluorophenyl)-6-methylidene-3-phenylpyridine |
|---|---|
| PubChem CID | 158448173 |
| Molecular Formula | C22H23F2N |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | ethane;1-ethyl-5-fluoro-2-(2-fluorophenyl)-6-methylidene-3-phenylpyridine |
| SMILES | C=C1C(F)=CC(c2ccccc2)=C(c2ccccc2F)N1CC.CC |
| InChI | InChI=1S/C20H17F2N.C2H6/c1-3-23-14(2)19(22)13-17(15-9-5-4-6-10-15)20(23)16-11-7-8-12-18(16)21;1-2/h4-13H,2-3H2,1H3;1-2H3 |
| InChIKey | HDQKSNJIYGIRQS-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|