C22H22Br2FN — CID 160569676
5-bromo-2-(2-bromo-6-fluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane (PubChem CID 160569676) has the molecular formula C22H22Br2FN and a molecular weight of 479.23 g/mol. Its IUPAC name is 5-bromo-2-(2-bromo-6-fluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane.
| Compound Name | 5-bromo-2-(2-bromo-6-fluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane |
|---|---|
| PubChem CID | 160569676 |
| Molecular Formula | C22H22Br2FN |
| Molecular Weight | 479.23 g/mol |
| Exact Mass | 477.01 |
| IUPAC Name | 5-bromo-2-(2-bromo-6-fluorophenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane |
| SMILES | C=C1C(Br)=CC(c2ccccc2)=C(c2c(F)cccc2Br)N1CC.CC |
| InChI | InChI=1S/C20H16Br2FN.C2H6/c1-3-24-13(2)17(22)12-15(14-8-5-4-6-9-14)20(24)19-16(21)10-7-11-18(19)23;1-2/h4-12H,2-3H2,1H3;1-2H3 |
| InChIKey | RAJNFTRWVKDBMX-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.23 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|