C23H24ClF2N — CID 162140911
5-chloro-2-(2,6-difluoro-4-methylphenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane (PubChem CID 162140911) has the molecular formula C23H24ClF2N and a molecular weight of 387.90 g/mol. Its IUPAC name is 5-chloro-2-(2,6-difluoro-4-methylphenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane.
| Compound Name | 5-chloro-2-(2,6-difluoro-4-methylphenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane |
|---|---|
| PubChem CID | 162140911 |
| Molecular Formula | C23H24ClF2N |
| Molecular Weight | 387.90 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 5-chloro-2-(2,6-difluoro-4-methylphenyl)-1-ethyl-6-methylidene-3-phenylpyridine;ethane |
| SMILES | C=C1C(Cl)=CC(c2ccccc2)=C(c2c(F)cc(C)cc2F)N1CC.CC |
| InChI | InChI=1S/C21H18ClF2N.C2H6/c1-4-25-14(3)17(22)12-16(15-8-6-5-7-9-15)21(25)20-18(23)10-13(2)11-19(20)24;1-2/h5-12H,3-4H2,1-2H3;1-2H3 |
| InChIKey | ZJXJBPBTVRVDHY-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.90 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|