C22H18BrF4NO — CID 158766166
5-bromo-2-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-1-ethyl-6-methylidene-3-phenylpyridine (PubChem CID 158766166) has the molecular formula C22H18BrF4NO and a molecular weight of 468.29 g/mol. Its IUPAC name is 5-bromo-2-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-1-ethyl-6-methylidene-3-phenylpyridine.
| Compound Name | 5-bromo-2-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-1-ethyl-6-methylidene-3-phenylpyridine |
|---|---|
| PubChem CID | 158766166 |
| Molecular Formula | C22H18BrF4NO |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 5-bromo-2-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-1-ethyl-6-methylidene-3-phenylpyridine |
| SMILES | C=C1C(Br)=CC(c2ccccc2)=C(c2c(F)cc(OCC(F)F)cc2F)N1CC |
| InChI | InChI=1S/C22H18BrF4NO/c1-3-28-13(2)17(23)11-16(14-7-5-4-6-8-14)22(28)21-18(24)9-15(10-19(21)25)29-12-20(26)27/h4-11,20H,2-3,12H2,1H3 |
| InChIKey | IAKLNPVOONEMGY-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|