C23H23F4NO — CID 162109193
2-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-1-methyl-6-methylidene-3-phenylpyridine;ethane (PubChem CID 162109193) has the molecular formula C23H23F4NO and a molecular weight of 405.44 g/mol. Its IUPAC name is 2-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-1-methyl-6-methylidene-3-phenylpyridine;ethane.
| Compound Name | 2-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-1-methyl-6-methylidene-3-phenylpyridine;ethane |
|---|---|
| PubChem CID | 162109193 |
| Molecular Formula | C23H23F4NO |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-1-methyl-6-methylidene-3-phenylpyridine;ethane |
| SMILES | C=C1C=CC(c2ccccc2)=C(c2c(F)cc(OCC(F)F)cc2F)N1C.CC |
| InChI | InChI=1S/C21H17F4NO.C2H6/c1-13-8-9-16(14-6-4-3-5-7-14)21(26(13)2)20-17(22)10-15(11-18(20)23)27-12-19(24)25;1-2/h3-11,19H,1,12H2,2H3;1-2H3 |
| InChIKey | ZFXPTFRYZRNMGS-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|