C22H21F4N — CID 161091403
1-(2,2-difluoroethyl)-2-(2,6-difluorophenyl)-6-methylidene-3-phenylpyridine;ethane (PubChem CID 161091403) has the molecular formula C22H21F4N and a molecular weight of 375.41 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-2-(2,6-difluorophenyl)-6-methylidene-3-phenylpyridine;ethane.
| Compound Name | 1-(2,2-difluoroethyl)-2-(2,6-difluorophenyl)-6-methylidene-3-phenylpyridine;ethane |
|---|---|
| PubChem CID | 161091403 |
| Molecular Formula | C22H21F4N |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-(2,2-difluoroethyl)-2-(2,6-difluorophenyl)-6-methylidene-3-phenylpyridine;ethane |
| SMILES | C=C1C=CC(c2ccccc2)=C(c2c(F)cccc2F)N1CC(F)F.CC |
| InChI | InChI=1S/C20H15F4N.C2H6/c1-13-10-11-15(14-6-3-2-4-7-14)20(25(13)12-18(23)24)19-16(21)8-5-9-17(19)22;1-2/h2-11,18H,1,12H2;1-2H3 |
| InChIKey | UHFMYMYUKBKWFU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|