C20H14BrF4N — CID 158261763
2-(2-bromo-4,6-difluorophenyl)-1-(2,2-difluoroethyl)-6-methylidene-3-phenylpyridine (PubChem CID 158261763) has the molecular formula C20H14BrF4N and a molecular weight of 424.24 g/mol. Its IUPAC name is 2-(2-bromo-4,6-difluorophenyl)-1-(2,2-difluoroethyl)-6-methylidene-3-phenylpyridine.
| Compound Name | 2-(2-bromo-4,6-difluorophenyl)-1-(2,2-difluoroethyl)-6-methylidene-3-phenylpyridine |
|---|---|
| PubChem CID | 158261763 |
| Molecular Formula | C20H14BrF4N |
| Molecular Weight | 424.24 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | 2-(2-bromo-4,6-difluorophenyl)-1-(2,2-difluoroethyl)-6-methylidene-3-phenylpyridine |
| SMILES | C=C1C=CC(c2ccccc2)=C(c2c(F)cc(F)cc2Br)N1CC(F)F |
| InChI | InChI=1S/C20H14BrF4N/c1-12-7-8-15(13-5-3-2-4-6-13)20(26(12)11-18(24)25)19-16(21)9-14(22)10-17(19)23/h2-10,18H,1,11H2 |
| InChIKey | SRFBZRLQFFFVQB-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.24 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|