C21H19F2N — CID 162039035
2-(2,6-difluoro-4-methylphenyl)-1-ethyl-6-methylidene-3-phenylpyridine (PubChem CID 162039035) has the molecular formula C21H19F2N and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-(2,6-difluoro-4-methylphenyl)-1-ethyl-6-methylidene-3-phenylpyridine.
| Compound Name | 2-(2,6-difluoro-4-methylphenyl)-1-ethyl-6-methylidene-3-phenylpyridine |
|---|---|
| PubChem CID | 162039035 |
| Molecular Formula | C21H19F2N |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-(2,6-difluoro-4-methylphenyl)-1-ethyl-6-methylidene-3-phenylpyridine |
| SMILES | C=C1C=CC(c2ccccc2)=C(c2c(F)cc(C)cc2F)N1CC |
| InChI | InChI=1S/C21H19F2N/c1-4-24-15(3)10-11-17(16-8-6-5-7-9-16)21(24)20-18(22)12-14(2)13-19(20)23/h5-13H,3-4H2,1-2H3 |
| InChIKey | XRCLAIBJEQOVQW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|