C21H19F4IN2 — CID 158492269
1-(2,2-difluoroethyl)-2-(3,5-difluoro-4-pyridinyl)-5-iodo-6-methylidene-3-phenylpyridine;ethane (PubChem CID 158492269) has the molecular formula C21H19F4IN2 and a molecular weight of 502.29 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-2-(3,5-difluoro-4-pyridinyl)-5-iodo-6-methylidene-3-phenylpyridine;ethane.
| Compound Name | 1-(2,2-difluoroethyl)-2-(3,5-difluoro-4-pyridinyl)-5-iodo-6-methylidene-3-phenylpyridine;ethane |
|---|---|
| PubChem CID | 158492269 |
| Molecular Formula | C21H19F4IN2 |
| Molecular Weight | 502.29 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | 1-(2,2-difluoroethyl)-2-(3,5-difluoro-4-pyridinyl)-5-iodo-6-methylidene-3-phenylpyridine;ethane |
| SMILES | C=C1C(I)=CC(c2ccccc2)=C(c2c(F)cncc2F)N1CC(F)F.CC |
| InChI | InChI=1S/C19H13F4IN2.C2H6/c1-11-16(24)7-13(12-5-3-2-4-6-12)19(26(11)10-17(22)23)18-14(20)8-25-9-15(18)21;1-2/h2-9,17H,1,10H2;1-2H3 |
| InChIKey | HIVOEGYVZLKBIZ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.29 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|