C21H16F4INO — CID 161271844
2-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-5-iodo-1-methyl-6-methylidene-3-phenylpyridine (PubChem CID 161271844) has the molecular formula C21H16F4INO and a molecular weight of 501.26 g/mol. Its IUPAC name is 2-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-5-iodo-1-methyl-6-methylidene-3-phenylpyridine.
| Compound Name | 2-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-5-iodo-1-methyl-6-methylidene-3-phenylpyridine |
|---|---|
| PubChem CID | 161271844 |
| Molecular Formula | C21H16F4INO |
| Molecular Weight | 501.26 g/mol |
| Exact Mass | 501.02 |
| IUPAC Name | 2-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-5-iodo-1-methyl-6-methylidene-3-phenylpyridine |
| SMILES | C=C1C(I)=CC(c2ccccc2)=C(c2c(F)cc(OCC(F)F)cc2F)N1C |
| InChI | InChI=1S/C21H16F4INO/c1-12-18(26)10-15(13-6-4-3-5-7-13)21(27(12)2)20-16(22)8-14(9-17(20)23)28-11-19(24)25/h3-10,19H,1,11H2,2H3 |
| InChIKey | MDKWYYAEAKRMBA-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.26 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|