C22H22BrF2N — CID 159359800
2-(4-bromo-2,6-difluorophenyl)-1,5-dimethyl-6-methylidene-3-phenylpyridine;ethane (PubChem CID 159359800) has the molecular formula C22H22BrF2N and a molecular weight of 418.33 g/mol. Its IUPAC name is 2-(4-bromo-2,6-difluorophenyl)-1,5-dimethyl-6-methylidene-3-phenylpyridine;ethane.
| Compound Name | 2-(4-bromo-2,6-difluorophenyl)-1,5-dimethyl-6-methylidene-3-phenylpyridine;ethane |
|---|---|
| PubChem CID | 159359800 |
| Molecular Formula | C22H22BrF2N |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-(4-bromo-2,6-difluorophenyl)-1,5-dimethyl-6-methylidene-3-phenylpyridine;ethane |
| SMILES | C=C1C(C)=CC(c2ccccc2)=C(c2c(F)cc(Br)cc2F)N1C.CC |
| InChI | InChI=1S/C20H16BrF2N.C2H6/c1-12-9-16(14-7-5-4-6-8-14)20(24(3)13(12)2)19-17(22)10-15(21)11-18(19)23;1-2/h4-11H,2H2,1,3H3;1-2H3 |
| InChIKey | LIJSUXFRVSRTQR-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|