C19H13BrClF2N — CID 158173923
2-(4-bromo-2,6-difluorophenyl)-5-chloro-1-methyl-6-methylidene-3-phenylpyridine (PubChem CID 158173923) has the molecular formula C19H13BrClF2N and a molecular weight of 408.67 g/mol. Its IUPAC name is 2-(4-bromo-2,6-difluorophenyl)-5-chloro-1-methyl-6-methylidene-3-phenylpyridine.
| Compound Name | 2-(4-bromo-2,6-difluorophenyl)-5-chloro-1-methyl-6-methylidene-3-phenylpyridine |
|---|---|
| PubChem CID | 158173923 |
| Molecular Formula | C19H13BrClF2N |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | 2-(4-bromo-2,6-difluorophenyl)-5-chloro-1-methyl-6-methylidene-3-phenylpyridine |
| SMILES | C=C1C(Cl)=CC(c2ccccc2)=C(c2c(F)cc(Br)cc2F)N1C |
| InChI | InChI=1S/C19H13BrClF2N/c1-11-15(21)10-14(12-6-4-3-5-7-12)19(24(11)2)18-16(22)8-13(20)9-17(18)23/h3-10H,1H2,2H3 |
| InChIKey | DRRXINACRVKQQM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|