C22H20F4IN — CID 157458491
1-(2,2-difluoroethyl)-2-(2,6-difluorophenyl)-5-iodo-6-methylidene-3-phenylpyridine;ethane (PubChem CID 157458491) has the molecular formula C22H20F4IN and a molecular weight of 501.31 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-2-(2,6-difluorophenyl)-5-iodo-6-methylidene-3-phenylpyridine;ethane.
| Compound Name | 1-(2,2-difluoroethyl)-2-(2,6-difluorophenyl)-5-iodo-6-methylidene-3-phenylpyridine;ethane |
|---|---|
| PubChem CID | 157458491 |
| Molecular Formula | C22H20F4IN |
| Molecular Weight | 501.31 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 1-(2,2-difluoroethyl)-2-(2,6-difluorophenyl)-5-iodo-6-methylidene-3-phenylpyridine;ethane |
| SMILES | C=C1C(I)=CC(c2ccccc2)=C(c2c(F)cccc2F)N1CC(F)F.CC |
| InChI | InChI=1S/C20H14F4IN.C2H6/c1-12-17(25)10-14(13-6-3-2-4-7-13)20(26(12)11-18(23)24)19-15(21)8-5-9-16(19)22;1-2/h2-10,18H,1,11H2;1-2H3 |
| InChIKey | BTQJSXRHJQRUQO-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.31 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|