C20H32O — CID 70383599
(1S,4S,9R,10S,13R,14R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-6-en-12-ol (PubChem CID 70383599) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (1S,4S,9R,10S,13R,14R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-6-en-12-ol.
| Compound Name | (1S,4S,9R,10S,13R,14R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-6-en-12-ol |
|---|---|
| PubChem CID | 70383599 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (1S,4S,9R,10S,13R,14R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-6-en-12-ol |
| SMILES | C[C@@H]1C[C@]23CC[C@H]4C(C)(C)C=CC[C@]4(C)[C@H]2CC(O)[C@@H]1C3 |
| InChI | InChI=1S/C20H32O/c1-13-11-20-9-6-16-18(2,3)7-5-8-19(16,4)17(20)10-15(21)14(13)12-20/h5,7,13-17,21H,6,8-12H2,1-4H3/t13-,14-,15?,16+,17-,19+,20+/m1/s1 |
| InChIKey | CEXREGDZRQEIBB-OIKSFYDPSA-N |
| XLogP | 4.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|