C18H24Cl2N2O2 — CID 7038980
(1S,2S)-1-(dichloromethyl)-N-(3-morpholin-4-ylpropyl)-2,3-dihydro-1H-indene-2-carboxamide (PubChem CID 7038980) has the molecular formula C18H24Cl2N2O2 and a molecular weight of 371.31 g/mol. Its IUPAC name is (1S,2S)-1-(dichloromethyl)-N-(3-morpholin-4-ylpropyl)-2,3-dihydro-1H-indene-2-carboxamide.
| Compound Name | (1S,2S)-1-(dichloromethyl)-N-(3-morpholin-4-ylpropyl)-2,3-dihydro-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 7038980 |
| Molecular Formula | C18H24Cl2N2O2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (1S,2S)-1-(dichloromethyl)-N-(3-morpholin-4-ylpropyl)-2,3-dihydro-1H-indene-2-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)[C@H]1Cc2ccccc2[C@H]1C(Cl)Cl |
| InChI | InChI=1S/C18H24Cl2N2O2/c19-17(20)16-14-5-2-1-4-13(14)12-15(16)18(23)21-6-3-7-22-8-10-24-11-9-22/h1-2,4-5,15-17H,3,6-12H2,(H,21,23)/t15-,16+/m0/s1 |
| InChIKey | HCDPYHLDBBGAFP-JKSUJKDBSA-N |
| XLogP | 2.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|