C26H33ClN4O2 — CID 93122992
(4aS,5S)-3-(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93122992) has the molecular formula C26H33ClN4O2 and a molecular weight of 469.03 g/mol. Its IUPAC name is (4aS,5S)-3-(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5S)-3-(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93122992 |
| Molecular Formula | C26H33ClN4O2 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (4aS,5S)-3-(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)[C@H]1Cc2ccccc2N2CCN(c3ccc(Cl)cc3)C[C@H]12 |
| InChI | InChI=1S/C26H33ClN4O2/c27-21-6-8-22(9-7-21)30-12-13-31-24-5-2-1-4-20(24)18-23(25(31)19-30)26(32)28-10-3-11-29-14-16-33-17-15-29/h1-2,4-9,23,25H,3,10-19H2,(H,28,32)/t23-,25+/m0/s1 |
| InChIKey | CSARZNGLHVMRSM-UKILVPOCSA-N |
| XLogP | 3.05 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|