C20H15N4OS+ — CID 7039313
12-acetyl-4-amino-11-methyl-6-phenyl-8-thia-10-aza-3-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-5-carbonitrile (PubChem CID 7039313) has the molecular formula C20H15N4OS+ and a molecular weight of 359.43 g/mol. Its IUPAC name is 12-acetyl-4-amino-11-methyl-6-phenyl-8-thia-10-aza-3-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-5-carbonitrile.
| Compound Name | 12-acetyl-4-amino-11-methyl-6-phenyl-8-thia-10-aza-3-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-5-carbonitrile |
|---|---|
| PubChem CID | 7039313 |
| Molecular Formula | C20H15N4OS+ |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 12-acetyl-4-amino-11-methyl-6-phenyl-8-thia-10-aza-3-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-5-carbonitrile |
| SMILES | CC(=O)c1cc2c(nc1C)sc1c(-c3ccccc3)c(C#N)c(N)[nH+]c12 |
| InChI | InChI=1S/C20H14N4OS/c1-10-13(11(2)25)8-14-17-18(26-20(14)23-10)16(12-6-4-3-5-7-12)15(9-21)19(22)24-17/h3-8H,1-2H3,(H2,22,24)/p+1 |
| InChIKey | ZWKWARFOGHEWGC-UHFFFAOYSA-O |
| XLogP | 3.90 |
| TPSA | 93.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |