C18H25N3O3 — CID 70393180
1-(tert-butylamino)-3-[2-(5-methyl-2-oxidopyridazin-2-ium-4-yl)phenoxy]propan-2-ol (PubChem CID 70393180) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-[2-(5-methyl-2-oxidopyridazin-2-ium-4-yl)phenoxy]propan-2-ol.
| Compound Name | 1-(tert-butylamino)-3-[2-(5-methyl-2-oxidopyridazin-2-ium-4-yl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 70393180 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-(tert-butylamino)-3-[2-(5-methyl-2-oxidopyridazin-2-ium-4-yl)phenoxy]propan-2-ol |
| SMILES | Cc1cn[n+]([O-])cc1-c1ccccc1OCC(O)CNC(C)(C)C |
| InChI | InChI=1S/C18H25N3O3/c1-13-9-20-21(23)11-16(13)15-7-5-6-8-17(15)24-12-14(22)10-19-18(2,3)4/h5-9,11,14,19,22H,10,12H2,1-4H3 |
| InChIKey | UTBIOJHKSVBOHD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|