C14H13Br3N2O6S — CID 70396998
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(3,4,5-tribromothiophen-2-yl)methyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 70396998) has the molecular formula C14H13Br3N2O6S and a molecular weight of 577.05 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(3,4,5-tribromothiophen-2-yl)methyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(3,4,5-tribromothiophen-2-yl)methyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70396998 |
| Molecular Formula | C14H13Br3N2O6S |
| Molecular Weight | 577.05 g/mol |
| Exact Mass | 573.80 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(3,4,5-tribromothiophen-2-yl)methyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@]2(Cc3sc(Br)c(Br)c3Br)O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C14H13Br3N2O6S/c15-8-6(26-12(17)9(8)16)3-14(11(23)10(22)5(4-20)25-14)19-2-1-7(21)18-13(19)24/h1-2,5,10-11,20,22-23H,3-4H2,(H,18,21,24)/t5-,10-,11-,14-/m1/s1 |
| InChIKey | YWPPKDSABBPCBY-KEDXZAOYSA-N |
| XLogP | 0.89 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.05 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |