C31H42F2O3 — CID 70400283
(2S)-2-cyclohexyl-4-ethyl-2-fluoro-6-[4-(3-fluoro-4-pentoxyphenyl)phenyl]hexanoic acid (PubChem CID 70400283) has the molecular formula C31H42F2O3 and a molecular weight of 500.67 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-4-ethyl-2-fluoro-6-[4-(3-fluoro-4-pentoxyphenyl)phenyl]hexanoic acid.
| Compound Name | (2S)-2-cyclohexyl-4-ethyl-2-fluoro-6-[4-(3-fluoro-4-pentoxyphenyl)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 70400283 |
| Molecular Formula | C31H42F2O3 |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | (2S)-2-cyclohexyl-4-ethyl-2-fluoro-6-[4-(3-fluoro-4-pentoxyphenyl)phenyl]hexanoic acid |
| SMILES | CCCCCOc1ccc(-c2ccc(CCC(CC)C[C@@](F)(C(=O)O)C3CCCCC3)cc2)cc1F |
| InChI | InChI=1S/C31H42F2O3/c1-3-5-9-20-36-29-19-18-26(21-28(29)32)25-16-14-24(15-17-25)13-12-23(4-2)22-31(33,30(34)35)27-10-7-6-8-11-27/h14-19,21,23,27H,3-13,20,22H2,1-2H3,(H,34,35)/t23?,31-/m0/s1 |
| InChIKey | CKYWIZYCQRFMFO-HPTWYVLESA-N |
| XLogP | 8.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|