C30H42FNO3 — CID 54033283
(2S)-2-cyclohexyl-2-fluoro-4-[[4-(5-hexyl-2-pyridinyl)phenoxy]methyl]hexanoic acid (PubChem CID 54033283) has the molecular formula C30H42FNO3 and a molecular weight of 483.67 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-fluoro-4-[[4-(5-hexyl-2-pyridinyl)phenoxy]methyl]hexanoic acid.
| Compound Name | (2S)-2-cyclohexyl-2-fluoro-4-[[4-(5-hexyl-2-pyridinyl)phenoxy]methyl]hexanoic acid |
|---|---|
| PubChem CID | 54033283 |
| Molecular Formula | C30H42FNO3 |
| Molecular Weight | 483.67 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | (2S)-2-cyclohexyl-2-fluoro-4-[[4-(5-hexyl-2-pyridinyl)phenoxy]methyl]hexanoic acid |
| SMILES | CCCCCCc1ccc(-c2ccc(OCC(CC)C[C@@](F)(C(=O)O)C3CCCCC3)cc2)nc1 |
| InChI | InChI=1S/C30H42FNO3/c1-3-5-6-8-11-24-14-19-28(32-21-24)25-15-17-27(18-16-25)35-22-23(4-2)20-30(31,29(33)34)26-12-9-7-10-13-26/h14-19,21,23,26H,3-13,20,22H2,1-2H3,(H,33,34)/t23?,30-/m0/s1 |
| InChIKey | LHDAXSXUBCECSE-POYPGSECSA-N |
| XLogP | 8.04 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.67 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|