C33H46ClFO4 — CID 70399032
(2R)-4-[[4-(3-chloro-4-octoxyphenyl)phenoxy]methyl]-2-cyclohexyl-2-fluorohexanoic acid (PubChem CID 70399032) has the molecular formula C33H46ClFO4 and a molecular weight of 561.18 g/mol. Its IUPAC name is (2R)-4-[[4-(3-chloro-4-octoxyphenyl)phenoxy]methyl]-2-cyclohexyl-2-fluorohexanoic acid.
| Compound Name | (2R)-4-[[4-(3-chloro-4-octoxyphenyl)phenoxy]methyl]-2-cyclohexyl-2-fluorohexanoic acid |
|---|---|
| PubChem CID | 70399032 |
| Molecular Formula | C33H46ClFO4 |
| Molecular Weight | 561.18 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | (2R)-4-[[4-(3-chloro-4-octoxyphenyl)phenoxy]methyl]-2-cyclohexyl-2-fluorohexanoic acid |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OCC(CC)C[C@](F)(C(=O)O)C3CCCCC3)cc2)cc1Cl |
| InChI | InChI=1S/C33H46ClFO4/c1-3-5-6-7-8-12-21-38-31-20-17-27(22-30(31)34)26-15-18-29(19-16-26)39-24-25(4-2)23-33(35,32(36)37)28-13-10-9-11-14-28/h15-20,22,25,28H,3-14,21,23-24H2,1-2H3,(H,36,37)/t25?,33-/m1/s1 |
| InChIKey | CZDCRTZGYFZFMC-SARHOQKNSA-N |
| XLogP | 9.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.18 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|