C34H48ClFO3 — CID 70400294
(2S)-6-[4-(3-chloro-4-octoxyphenyl)phenyl]-2-cyclohexyl-4-ethyl-2-fluorohexanoic acid (PubChem CID 70400294) has the molecular formula C34H48ClFO3 and a molecular weight of 559.21 g/mol. Its IUPAC name is (2S)-6-[4-(3-chloro-4-octoxyphenyl)phenyl]-2-cyclohexyl-4-ethyl-2-fluorohexanoic acid.
| Compound Name | (2S)-6-[4-(3-chloro-4-octoxyphenyl)phenyl]-2-cyclohexyl-4-ethyl-2-fluorohexanoic acid |
|---|---|
| PubChem CID | 70400294 |
| Molecular Formula | C34H48ClFO3 |
| Molecular Weight | 559.21 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | (2S)-6-[4-(3-chloro-4-octoxyphenyl)phenyl]-2-cyclohexyl-4-ethyl-2-fluorohexanoic acid |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(CCC(CC)C[C@@](F)(C(=O)O)C3CCCCC3)cc2)cc1Cl |
| InChI | InChI=1S/C34H48ClFO3/c1-3-5-6-7-8-12-23-39-32-22-21-29(24-31(32)35)28-19-17-27(18-20-28)16-15-26(4-2)25-34(36,33(37)38)30-13-10-9-11-14-30/h17-22,24,26,30H,3-16,23,25H2,1-2H3,(H,37,38)/t26?,34-/m0/s1 |
| InChIKey | YQROUCPHCCKTLU-BFZOCEIISA-N |
| XLogP | 10.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.21 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|