C17H30N6 — CID 70407144
3-[1,3-di(piperazin-1-yl)propyl]benzene-1,2-diamine (PubChem CID 70407144) has the molecular formula C17H30N6 and a molecular weight of 318.47 g/mol. Its IUPAC name is 3-[1,3-di(piperazin-1-yl)propyl]benzene-1,2-diamine.
| Compound Name | 3-[1,3-di(piperazin-1-yl)propyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 70407144 |
| Molecular Formula | C17H30N6 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | 3-[1,3-di(piperazin-1-yl)propyl]benzene-1,2-diamine |
| SMILES | Nc1cccc(C(CCN2CCNCC2)N2CCNCC2)c1N |
| InChI | InChI=1S/C17H30N6/c18-15-3-1-2-14(17(15)19)16(23-12-7-21-8-13-23)4-9-22-10-5-20-6-11-22/h1-3,16,20-21H,4-13,18-19H2 |
| InChIKey | VQFAMAOFSPXIMO-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 82.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|