C18H25ClN2 — CID 70411888
2-(4-tert-butylphenyl)-4-(3-chloro-2-methylpropyl)-5-methyl-1H-imidazole (PubChem CID 70411888) has the molecular formula C18H25ClN2 and a molecular weight of 304.87 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-4-(3-chloro-2-methylpropyl)-5-methyl-1H-imidazole.
| Compound Name | 2-(4-tert-butylphenyl)-4-(3-chloro-2-methylpropyl)-5-methyl-1H-imidazole |
|---|---|
| PubChem CID | 70411888 |
| Molecular Formula | C18H25ClN2 |
| Molecular Weight | 304.87 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-(4-tert-butylphenyl)-4-(3-chloro-2-methylpropyl)-5-methyl-1H-imidazole |
| SMILES | Cc1[nH]c(-c2ccc(C(C)(C)C)cc2)nc1CC(C)CCl |
| InChI | InChI=1S/C18H25ClN2/c1-12(11-19)10-16-13(2)20-17(21-16)14-6-8-15(9-7-14)18(3,4)5/h6-9,12H,10-11H2,1-5H3,(H,20,21) |
| InChIKey | VJGYUBBDCUREQB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.87 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|