C11H12O2 — CID 70416089
2-penta-1,4-dienoxyphenol (PubChem CID 70416089) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 2-penta-1,4-dienoxyphenol.
| Compound Name | 2-penta-1,4-dienoxyphenol |
|---|---|
| PubChem CID | 70416089 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2-penta-1,4-dienoxyphenol |
| SMILES | C=CCC=COc1ccccc1O |
| InChI | InChI=1S/C11H12O2/c1-2-3-6-9-13-11-8-5-4-7-10(11)12/h2,4-9,12H,1,3H2 |
| InChIKey | QRFKJMIYJYIVKJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|