C16H22ClFN2O2 — CID 70421486
1-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)-3-[(Z)-hex-2-en-3-yl]urea (PubChem CID 70421486) has the molecular formula C16H22ClFN2O2 and a molecular weight of 328.82 g/mol. Its IUPAC name is 1-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)-3-[(Z)-hex-2-en-3-yl]urea.
| Compound Name | 1-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)-3-[(Z)-hex-2-en-3-yl]urea |
|---|---|
| PubChem CID | 70421486 |
| Molecular Formula | C16H22ClFN2O2 |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)-3-[(Z)-hex-2-en-3-yl]urea |
| SMILES | C/C=C(/CCC)NC(=O)Nc1cc(OC(C)C)c(Cl)cc1F |
| InChI | InChI=1S/C16H22ClFN2O2/c1-5-7-11(6-2)19-16(21)20-14-9-15(22-10(3)4)12(17)8-13(14)18/h6,8-10H,5,7H2,1-4H3,(H2,19,20,21)/b11-6- |
| InChIKey | DCMNSDUYRITUFS-WDZFZDKYSA-N |
| XLogP | 5.09 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |