C17H23ClFN3O3S — CID 88731689
ethyl 2-[(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamothioyl]diazinane-3-carboxylate (PubChem CID 88731689) has the molecular formula C17H23ClFN3O3S and a molecular weight of 403.91 g/mol. Its IUPAC name is ethyl 2-[(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamothioyl]diazinane-3-carboxylate.
| Compound Name | ethyl 2-[(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamothioyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 88731689 |
| Molecular Formula | C17H23ClFN3O3S |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | ethyl 2-[(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamothioyl]diazinane-3-carboxylate |
| SMILES | CCOC(=O)C1CCCNN1C(=S)Nc1cc(OC(C)C)c(Cl)cc1F |
| InChI | InChI=1S/C17H23ClFN3O3S/c1-4-24-16(23)14-6-5-7-20-22(14)17(26)21-13-9-15(25-10(2)3)11(18)8-12(13)19/h8-10,14,20H,4-7H2,1-3H3,(H,21,26) |
| InChIKey | JPVSHKINVCYCLF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|