C18H25ClFN3O2S2 — CID 14622846
pentyl 2-[2-chloro-5-(diazinane-1-carbothioylamino)-4-fluorophenyl]sulfanylacetate (PubChem CID 14622846) has the molecular formula C18H25ClFN3O2S2 and a molecular weight of 434.00 g/mol. Its IUPAC name is pentyl 2-[2-chloro-5-(diazinane-1-carbothioylamino)-4-fluorophenyl]sulfanylacetate.
| Compound Name | pentyl 2-[2-chloro-5-(diazinane-1-carbothioylamino)-4-fluorophenyl]sulfanylacetate |
|---|---|
| PubChem CID | 14622846 |
| Molecular Formula | C18H25ClFN3O2S2 |
| Molecular Weight | 434.00 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | pentyl 2-[2-chloro-5-(diazinane-1-carbothioylamino)-4-fluorophenyl]sulfanylacetate |
| SMILES | CCCCCOC(=O)CSc1cc(NC(=S)N2CCCCN2)c(F)cc1Cl |
| InChI | InChI=1S/C18H25ClFN3O2S2/c1-2-3-6-9-25-17(24)12-27-16-11-15(14(20)10-13(16)19)22-18(26)23-8-5-4-7-21-23/h10-11,21H,2-9,12H2,1H3,(H,22,26) |
| InChIKey | INMNBTQVIOQWGV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.00 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|