C14H17ClFN3O3S2 — CID 101198907
methyl 2-[2-chloro-5-(diazinan-1-ylsulfanylcarbonylamino)-4-fluorophenyl]sulfanylacetate (PubChem CID 101198907) has the molecular formula C14H17ClFN3O3S2 and a molecular weight of 393.89 g/mol. Its IUPAC name is methyl 2-[2-chloro-5-(diazinan-1-ylsulfanylcarbonylamino)-4-fluorophenyl]sulfanylacetate.
| Compound Name | methyl 2-[2-chloro-5-(diazinan-1-ylsulfanylcarbonylamino)-4-fluorophenyl]sulfanylacetate |
|---|---|
| PubChem CID | 101198907 |
| Molecular Formula | C14H17ClFN3O3S2 |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | methyl 2-[2-chloro-5-(diazinan-1-ylsulfanylcarbonylamino)-4-fluorophenyl]sulfanylacetate |
| SMILES | COC(=O)CSc1cc(NC(=O)SN2CCCCN2)c(F)cc1Cl |
| InChI | InChI=1S/C14H17ClFN3O3S2/c1-22-13(20)8-23-12-7-11(10(16)6-9(12)15)18-14(21)24-19-5-3-2-4-17-19/h6-7,17H,2-5,8H2,1H3,(H,18,21) |
| InChIKey | HTGFLGWWCOWSIM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|