C20H30ClFN5O8PS2 — CID 137481558
methyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate;N-methylmethanamine;2-(phosphonomethylamino)acetic acid (PubChem CID 137481558) has the molecular formula C20H30ClFN5O8PS2 and a molecular weight of 618.05 g/mol. Its IUPAC name is methyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate;N-methylmethanamine;2-(phosphonomethylamino)acetic acid.
| Compound Name | methyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate;N-methylmethanamine;2-(phosphonomethylamino)acetic acid |
|---|---|
| PubChem CID | 137481558 |
| Molecular Formula | C20H30ClFN5O8PS2 |
| Molecular Weight | 618.05 g/mol |
| Exact Mass | 617.09 |
| IUPAC Name | methyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate;N-methylmethanamine;2-(phosphonomethylamino)acetic acid |
| SMILES | CNC.COC(=O)CSc1cc(/N=c2\sc(=O)n3n2CCCC3)c(F)cc1Cl.O=C(O)CNCP(=O)(O)O |
| InChI | InChI=1S/C15H15ClFN3O3S2.C3H8NO5P.C2H7N/c1-23-13(21)8-24-12-7-11(10(17)6-9(12)16)18-14-19-4-2-3-5-20(19)15(22)25-14;5-3(6)1-4-2-10(7,8)9;1-3-2/h6-7H,2-5,8H2,1H3;4H,1-2H2,(H,5,6)(H2,7,8,9);3H,1-2H3/b18-14-;; |
| InChIKey | OMVXOBPCNQEZFM-RQNMHTNWSA-N |
| XLogP | 1.43 |
| TPSA | 184.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.05 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|