C15H17ClFN3O3S2 — CID 59960073
1-[4-chloro-2-fluoro-5-(2-methylperoxyethylsulfanyl)phenyl]imino-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-3-one (PubChem CID 59960073) has the molecular formula C15H17ClFN3O3S2 and a molecular weight of 405.90 g/mol. Its IUPAC name is 1-[4-chloro-2-fluoro-5-(2-methylperoxyethylsulfanyl)phenyl]imino-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-3-one.
| Compound Name | 1-[4-chloro-2-fluoro-5-(2-methylperoxyethylsulfanyl)phenyl]imino-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-3-one |
|---|---|
| PubChem CID | 59960073 |
| Molecular Formula | C15H17ClFN3O3S2 |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 1-[4-chloro-2-fluoro-5-(2-methylperoxyethylsulfanyl)phenyl]imino-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-3-one |
| SMILES | COOCCSc1cc(/N=c2\sc(=O)n3n2CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C15H17ClFN3O3S2/c1-22-23-6-7-24-13-9-12(11(17)8-10(13)16)18-14-19-4-2-3-5-20(19)15(21)25-14/h8-9H,2-7H2,1H3/b18-14- |
| InChIKey | LIGOFKYHFVVGOA-JXAWBTAJSA-N |
| XLogP | 3.20 |
| TPSA | 57.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|