C17H18ClFN4O3S2 — CID 14555718
(propan-2-ylideneamino) 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate (PubChem CID 14555718) has the molecular formula C17H18ClFN4O3S2 and a molecular weight of 444.94 g/mol. Its IUPAC name is (propan-2-ylideneamino) 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate.
| Compound Name | (propan-2-ylideneamino) 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 14555718 |
| Molecular Formula | C17H18ClFN4O3S2 |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | (propan-2-ylideneamino) 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate |
| SMILES | CC(C)=NOC(=O)CSc1cc(/N=c2\sc(=O)n3n2CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C17H18ClFN4O3S2/c1-10(2)21-26-15(24)9-27-14-8-13(12(19)7-11(14)18)20-16-22-5-3-4-6-23(22)17(25)28-16/h7-8H,3-6,9H2,1-2H3/b20-16- |
| InChIKey | QPDHNHIPVJZNGQ-SILNSSARSA-N |
| XLogP | 3.56 |
| TPSA | 77.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|