C20H26N5O+ — CID 7042326
2-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-5,7-dimethylimidazo[1,2-a]pyrimidine (PubChem CID 7042326) has the molecular formula C20H26N5O+ and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-5,7-dimethylimidazo[1,2-a]pyrimidine.
| Compound Name | 2-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-5,7-dimethylimidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 7042326 |
| Molecular Formula | C20H26N5O+ |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-5,7-dimethylimidazo[1,2-a]pyrimidine |
| SMILES | COc1ccc(N2CC[NH+](Cc3cn4c(C)cc(C)nc4n3)CC2)cc1 |
| InChI | InChI=1S/C20H25N5O/c1-15-12-16(2)25-14-17(22-20(25)21-15)13-23-8-10-24(11-9-23)18-4-6-19(26-3)7-5-18/h4-7,12,14H,8-11,13H2,1-3H3/p+1 |
| InChIKey | ROXQJIRDKKWODO-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 47.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|