C29H47FO3 — CID 70425200
[3-fluoro-4-[2-(4-propylcyclohexyl)ethyl]phenyl] hydrogen carbonate;pentylcyclohexane (PubChem CID 70425200) has the molecular formula C29H47FO3 and a molecular weight of 462.69 g/mol. Its IUPAC name is [3-fluoro-4-[2-(4-propylcyclohexyl)ethyl]phenyl] hydrogen carbonate;pentylcyclohexane.
| Compound Name | [3-fluoro-4-[2-(4-propylcyclohexyl)ethyl]phenyl] hydrogen carbonate;pentylcyclohexane |
|---|---|
| PubChem CID | 70425200 |
| Molecular Formula | C29H47FO3 |
| Molecular Weight | 462.69 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | [3-fluoro-4-[2-(4-propylcyclohexyl)ethyl]phenyl] hydrogen carbonate;pentylcyclohexane |
| SMILES | CCCC1CCC(CCc2ccc(OC(=O)O)cc2F)CC1.CCCCCC1CCCCC1 |
| InChI | InChI=1S/C18H25FO3.C11H22/c1-2-3-13-4-6-14(7-5-13)8-9-15-10-11-16(12-17(15)19)22-18(20)21;1-2-3-5-8-11-9-6-4-7-10-11/h10-14H,2-9H2,1H3,(H,20,21);11H,2-10H2,1H3 |
| InChIKey | YRLVTRQIYVTGKE-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.69 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|