C20H16N7O5S+ — CID 7043025
[(3S)-3-cyano-5-[5-nitro-2-(1-phenyltetrazol-5-yl)sulfanylbenzoyl]oxy-4-oxopent-1-en-2-yl]azanium (PubChem CID 7043025) has the molecular formula C20H16N7O5S+ and a molecular weight of 466.46 g/mol. Its IUPAC name is [(3S)-3-cyano-5-[5-nitro-2-(1-phenyltetrazol-5-yl)sulfanylbenzoyl]oxy-4-oxopent-1-en-2-yl]azanium.
| Compound Name | [(3S)-3-cyano-5-[5-nitro-2-(1-phenyltetrazol-5-yl)sulfanylbenzoyl]oxy-4-oxopent-1-en-2-yl]azanium |
|---|---|
| PubChem CID | 7043025 |
| Molecular Formula | C20H16N7O5S+ |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | [(3S)-3-cyano-5-[5-nitro-2-(1-phenyltetrazol-5-yl)sulfanylbenzoyl]oxy-4-oxopent-1-en-2-yl]azanium |
| SMILES | C=C([NH3+])[C@@H](C#N)C(=O)COC(=O)c1cc([N+](=O)[O-])ccc1Sc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C20H15N7O5S/c1-12(22)16(10-21)17(28)11-32-19(29)15-9-14(27(30)31)7-8-18(15)33-20-23-24-25-26(20)13-5-3-2-4-6-13/h2-9,16H,1,11,22H2/p+1/t16-/m1/s1 |
| InChIKey | RPTOIQUJEHVVTP-MRXNPFEDSA-O |
| XLogP | 1.34 |
| TPSA | 181.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|