C24H26N4O4 — CID 70434304
bis[2-(1H-imidazol-2-yl)pent-4-enyl] benzene-1,2-dicarboxylate (PubChem CID 70434304) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is bis[2-(1H-imidazol-2-yl)pent-4-enyl] benzene-1,2-dicarboxylate.
| Compound Name | bis[2-(1H-imidazol-2-yl)pent-4-enyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 70434304 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | bis[2-(1H-imidazol-2-yl)pent-4-enyl] benzene-1,2-dicarboxylate |
| SMILES | C=CCC(COC(=O)c1ccccc1C(=O)OCC(CC=C)c1ncc[nH]1)c1ncc[nH]1 |
| InChI | InChI=1S/C24H26N4O4/c1-3-7-17(21-25-11-12-26-21)15-31-23(29)19-9-5-6-10-20(19)24(30)32-16-18(8-4-2)22-27-13-14-28-22/h3-6,9-14,17-18H,1-2,7-8,15-16H2,(H,25,26)(H,27,28) |
| InChIKey | XGXATGMVJIUOTK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|