C19H19ClN2 — CID 70434612
(1S,19S)-8-chloro-2-methyl-2,5-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-6(11),7,9,13(18),14,16-hexaene (PubChem CID 70434612) has the molecular formula C19H19ClN2 and a molecular weight of 310.83 g/mol. Its IUPAC name is (1S,19S)-8-chloro-2-methyl-2,5-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-6(11),7,9,13(18),14,16-hexaene.
| Compound Name | (1S,19S)-8-chloro-2-methyl-2,5-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-6(11),7,9,13(18),14,16-hexaene |
|---|---|
| PubChem CID | 70434612 |
| Molecular Formula | C19H19ClN2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (1S,19S)-8-chloro-2-methyl-2,5-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-6(11),7,9,13(18),14,16-hexaene |
| SMILES | CN1CCN2c3cc(Cl)ccc3Cc3cccc4c3[C@H]2[C@@H]1C4 |
| InChI | InChI=1S/C19H19ClN2/c1-21-7-8-22-16-11-15(20)6-5-12(16)9-13-3-2-4-14-10-17(21)19(22)18(13)14/h2-6,11,17,19H,7-10H2,1H3/t17-,19+/m0/s1 |
| InChIKey | GSKGBJPOILWRSS-PKOBYXMFSA-N |
| XLogP | 3.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|