C21H22N2 — CID 70436215
(1S,19S)-2-prop-2-enyl-2,5-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-6,8,10,13(18),14,16-hexaene (PubChem CID 70436215) has the molecular formula C21H22N2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (1S,19S)-2-prop-2-enyl-2,5-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-6,8,10,13(18),14,16-hexaene.
| Compound Name | (1S,19S)-2-prop-2-enyl-2,5-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-6,8,10,13(18),14,16-hexaene |
|---|---|
| PubChem CID | 70436215 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | (1S,19S)-2-prop-2-enyl-2,5-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-6,8,10,13(18),14,16-hexaene |
| SMILES | C=CCN1CCN2c3ccccc3Cc3cccc4c3[C@H]2[C@@H]1C4 |
| InChI | InChI=1S/C21H22N2/c1-2-10-22-11-12-23-18-9-4-3-6-15(18)13-16-7-5-8-17-14-19(22)21(23)20(16)17/h2-9,19,21H,1,10-14H2/t19-,21+/m0/s1 |
| InChIKey | HNOOUWJEPBGWJU-PZJWPPBQSA-N |
| XLogP | 3.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|