C23H26N2O2 — CID 70435698
ethyl 3-[(1S,19S)-2,5-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-6,8,10,13(18),14,16-hexaen-2-yl]propanoate (PubChem CID 70435698) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is ethyl 3-[(1S,19S)-2,5-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-6,8,10,13(18),14,16-hexaen-2-yl]propanoate.
| Compound Name | ethyl 3-[(1S,19S)-2,5-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-6,8,10,13(18),14,16-hexaen-2-yl]propanoate |
|---|---|
| PubChem CID | 70435698 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | ethyl 3-[(1S,19S)-2,5-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-6,8,10,13(18),14,16-hexaen-2-yl]propanoate |
| SMILES | CCOC(=O)CCN1CCN2c3ccccc3Cc3cccc4c3[C@H]2[C@@H]1C4 |
| InChI | InChI=1S/C23H26N2O2/c1-2-27-21(26)10-11-24-12-13-25-19-9-4-3-6-16(19)14-17-7-5-8-18-15-20(24)23(25)22(17)18/h3-9,20,23H,2,10-15H2,1H3/t20-,23+/m0/s1 |
| InChIKey | YWLGGOOVZYVZIE-NZQKXSOJSA-N |
| XLogP | 3.33 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|