C17H27NO3Si — CID 70439150
1-trimethylsilylethyl N-[2-(hydroxymethyl)-5,6,7,8-tetrahydronaphthalen-1-yl]carbamate (PubChem CID 70439150) has the molecular formula C17H27NO3Si and a molecular weight of 321.49 g/mol. Its IUPAC name is 1-trimethylsilylethyl N-[2-(hydroxymethyl)-5,6,7,8-tetrahydronaphthalen-1-yl]carbamate.
| Compound Name | 1-trimethylsilylethyl N-[2-(hydroxymethyl)-5,6,7,8-tetrahydronaphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 70439150 |
| Molecular Formula | C17H27NO3Si |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 1-trimethylsilylethyl N-[2-(hydroxymethyl)-5,6,7,8-tetrahydronaphthalen-1-yl]carbamate |
| SMILES | CC(OC(=O)Nc1c(CO)ccc2c1CCCC2)[Si](C)(C)C |
| InChI | InChI=1S/C17H27NO3Si/c1-12(22(2,3)4)21-17(20)18-16-14(11-19)10-9-13-7-5-6-8-15(13)16/h9-10,12,19H,5-8,11H2,1-4H3,(H,18,20) |
| InChIKey | ZMTQGHOYQMRTFA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|