C12H13Cl3NO2+ — CID 7044222
[(2S)-5,7-dimethyl-4-oxo-2-(trichloromethyl)-3H-chromen-2-yl]azanium (PubChem CID 7044222) has the molecular formula C12H13Cl3NO2+ and a molecular weight of 309.60 g/mol. Its IUPAC name is [(2S)-5,7-dimethyl-4-oxo-2-(trichloromethyl)-3H-chromen-2-yl]azanium.
| Compound Name | [(2S)-5,7-dimethyl-4-oxo-2-(trichloromethyl)-3H-chromen-2-yl]azanium |
|---|---|
| PubChem CID | 7044222 |
| Molecular Formula | C12H13Cl3NO2+ |
| Molecular Weight | 309.60 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | [(2S)-5,7-dimethyl-4-oxo-2-(trichloromethyl)-3H-chromen-2-yl]azanium |
| SMILES | Cc1cc(C)c2c(c1)O[C@]([NH3+])(C(Cl)(Cl)Cl)CC2=O |
| InChI | InChI=1S/C12H12Cl3NO2/c1-6-3-7(2)10-8(17)5-11(16,12(13,14)15)18-9(10)4-6/h3-4H,5,16H2,1-2H3/p+1/t11-/m0/s1 |
| InChIKey | SUXXSHIJUBVHBQ-NSHDSACASA-O |
| XLogP | 2.58 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.60 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|